C16H14FN3O — CID 110653357
N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-fluoroaniline (PubChem CID 110653357) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-fluoroaniline.
| Compound Name | N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 110653357 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-fluoroaniline |
| SMILES | Fc1ccccc1NCc1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C16H14FN3O/c17-13-8-4-5-9-14(13)18-11-16-20-19-15(21-16)10-12-6-2-1-3-7-12/h1-9,18H,10-11H2 |
| InChIKey | SHNFHBLVLZTTOZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |