C17H18ClN3O3 — CID 122156506
2-chloro-4-(dimethylcarbamoylamino)-N-(2-hydroxy-5-methylphenyl)benzamide (PubChem CID 122156506) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 2-chloro-4-(dimethylcarbamoylamino)-N-(2-hydroxy-5-methylphenyl)benzamide.
| Compound Name | 2-chloro-4-(dimethylcarbamoylamino)-N-(2-hydroxy-5-methylphenyl)benzamide |
|---|---|
| PubChem CID | 122156506 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-chloro-4-(dimethylcarbamoylamino)-N-(2-hydroxy-5-methylphenyl)benzamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2ccc(NC(=O)N(C)C)cc2Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-10-4-7-15(22)14(8-10)20-16(23)12-6-5-11(9-13(12)18)19-17(24)21(2)3/h4-9,22H,1-3H3,(H,19,24)(H,20,23) |
| InChIKey | OBPCKJQCSSRLQW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|