C15H15NO3S2 — CID 122157340
methyl 3-[(4-acetamidophenyl)sulfanylmethyl]thiophene-2-carboxylate (PubChem CID 122157340) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[(4-acetamidophenyl)sulfanylmethyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-acetamidophenyl)sulfanylmethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 122157340 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | methyl 3-[(4-acetamidophenyl)sulfanylmethyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1CSc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C15H15NO3S2/c1-10(17)16-12-3-5-13(6-4-12)21-9-11-7-8-20-14(11)15(18)19-2/h3-8H,9H2,1-2H3,(H,16,17) |
| InChIKey | RDYFBODPEWDANT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |