C18H23NO3 — CID 122157408
N,N-di(butan-2-yl)-1-oxoisochromene-3-carboxamide (PubChem CID 122157408) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-1-oxoisochromene-3-carboxamide.
| Compound Name | N,N-di(butan-2-yl)-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 122157408 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N,N-di(butan-2-yl)-1-oxoisochromene-3-carboxamide |
| SMILES | CCC(C)N(C(=O)c1cc2ccccc2c(=O)o1)C(C)CC |
| InChI | InChI=1S/C18H23NO3/c1-5-12(3)19(13(4)6-2)17(20)16-11-14-9-7-8-10-15(14)18(21)22-16/h7-13H,5-6H2,1-4H3 |
| InChIKey | HXWYULXMJZIVCS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |