C15H16ClNO3S — CID 122162583
3-chloro-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]benzamide (PubChem CID 122162583) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]benzamide.
| Compound Name | 3-chloro-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]benzamide |
|---|---|
| PubChem CID | 122162583 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-chloro-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]benzamide |
| SMILES | O=C(NCC(OCCO)c1ccsc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H16ClNO3S/c16-13-3-1-2-11(8-13)15(19)17-9-14(20-6-5-18)12-4-7-21-10-12/h1-4,7-8,10,14,18H,5-6,9H2,(H,17,19) |
| InChIKey | UOAUJNRDHREOCH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |