C18H22ClNO4S — CID 122162608
2-(4-chlorophenoxy)-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]-2-methylpropanamide (PubChem CID 122162608) has the molecular formula C18H22ClNO4S and a molecular weight of 383.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 122162608 |
| Molecular Formula | C18H22ClNO4S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-(2-hydroxyethoxy)-2-thiophen-3-ylethyl]-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCC(OCCO)c1ccsc1 |
| InChI | InChI=1S/C18H22ClNO4S/c1-18(2,24-15-5-3-14(19)4-6-15)17(22)20-11-16(23-9-8-21)13-7-10-25-12-13/h3-7,10,12,16,21H,8-9,11H2,1-2H3,(H,20,22) |
| InChIKey | ADIBSVAHEMYNSD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |