C29H36N6O5S — CID 122165164
(1R,5S,21S,24R)-24-[4-(methoxymethyl)triazol-1-yl]-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione (PubChem CID 122165164) has the molecular formula C29H36N6O5S and a molecular weight of 580.71 g/mol. Its IUPAC name is (1R,5S,21S,24R)-24-[4-(methoxymethyl)triazol-1-yl]-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24R)-24-[4-(methoxymethyl)triazol-1-yl]-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
|---|---|
| PubChem CID | 122165164 |
| Molecular Formula | C29H36N6O5S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | (1R,5S,21S,24R)-24-[4-(methoxymethyl)triazol-1-yl]-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
| SMILES | COCc1cn([C@@H]2CC[C@H]3CCOc4ccccc4C(=O)N4CCN(Cc5ccsc5)C[C@H]4C(=O)NC[C@H]2O3)nn1 |
| InChI | InChI=1S/C29H36N6O5S/c1-38-18-21-16-35(32-31-21)24-7-6-22-8-12-39-26-5-3-2-4-23(26)29(37)34-11-10-33(15-20-9-13-41-19-20)17-25(34)28(36)30-14-27(24)40-22/h2-5,9,13,16,19,22,24-25,27H,6-8,10-12,14-15,17-18H2,1H3,(H,30,36)/t22-,24+,25-,27+/m0/s1 |
| InChIKey | QSXWPEBOBBLWLW-CFJXPYFLSA-N |
| XLogP | 2.50 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |