C9H11F2N5 — CID 122166507
1-(difluoromethyl)-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine (PubChem CID 122166507) has the molecular formula C9H11F2N5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine.
| Compound Name | 1-(difluoromethyl)-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 122166507 |
| Molecular Formula | C9H11F2N5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 1-(difluoromethyl)-N-[(2-methylpyrazol-3-yl)methyl]pyrazol-3-amine |
| SMILES | Cn1nccc1CNc1ccn(C(F)F)n1 |
| InChI | InChI=1S/C9H11F2N5/c1-15-7(2-4-13-15)6-12-8-3-5-16(14-8)9(10)11/h2-5,9H,6H2,1H3,(H,12,14) |
| InChIKey | DFCBOBDVNHIBMI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |