C12H15N3O — CID 122168879
3-cyclopropyl-N-(furan-2-ylmethyl)-1-methylpyrazol-5-amine (PubChem CID 122168879) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-cyclopropyl-N-(furan-2-ylmethyl)-1-methylpyrazol-5-amine.
| Compound Name | 3-cyclopropyl-N-(furan-2-ylmethyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 122168879 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-cyclopropyl-N-(furan-2-ylmethyl)-1-methylpyrazol-5-amine |
| SMILES | Cn1nc(C2CC2)cc1NCc1ccco1 |
| InChI | InChI=1S/C12H15N3O/c1-15-12(7-11(14-15)9-4-5-9)13-8-10-3-2-6-16-10/h2-3,6-7,9,13H,4-5,8H2,1H3 |
| InChIKey | QBGAETIUCPWQEX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |