C10H15F3N2O — CID 122171757
1-butan-2-yl-3-(2,2,2-trifluoroethoxymethyl)pyrazole (PubChem CID 122171757) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2,2,2-trifluoroethoxymethyl)pyrazole.
| Compound Name | 1-butan-2-yl-3-(2,2,2-trifluoroethoxymethyl)pyrazole |
|---|---|
| PubChem CID | 122171757 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-butan-2-yl-3-(2,2,2-trifluoroethoxymethyl)pyrazole |
| SMILES | CCC(C)n1ccc(COCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N2O/c1-3-8(2)15-5-4-9(14-15)6-16-7-10(11,12)13/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | PEWOVGTYDKRTOW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |