C27H32FN3O2S — CID 122172700
7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxymethyl]-6-fluoro-2-methyl-3,4-dihydroisoquinolin-1-one (PubChem CID 122172700) has the molecular formula C27H32FN3O2S and a molecular weight of 481.64 g/mol. Its IUPAC name is 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxymethyl]-6-fluoro-2-methyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxymethyl]-6-fluoro-2-methyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 122172700 |
| Molecular Formula | C27H32FN3O2S |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 7-[4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxymethyl]-6-fluoro-2-methyl-3,4-dihydroisoquinolin-1-one |
| SMILES | CN1CCc2cc(F)c(COCCCCN3CCN(c4cccc5sccc45)CC3)cc2C1=O |
| InChI | InChI=1S/C27H32FN3O2S/c1-29-10-7-20-18-24(28)21(17-23(20)27(29)32)19-33-15-3-2-9-30-11-13-31(14-12-30)25-5-4-6-26-22(25)8-16-34-26/h4-6,8,16-18H,2-3,7,9-15,19H2,1H3 |
| InChIKey | WAJUKWCONSQXQF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|