C16H16N6O3S2 — CID 122179669
1-(5-methylpyrrolo[1,2-b]pyridazin-6-yl)-3-[(4-sulfamoylphenyl)carbamothioyl]urea (PubChem CID 122179669) has the molecular formula C16H16N6O3S2 and a molecular weight of 404.48 g/mol. Its IUPAC name is 1-(5-methylpyrrolo[1,2-b]pyridazin-6-yl)-3-[(4-sulfamoylphenyl)carbamothioyl]urea.
| Compound Name | 1-(5-methylpyrrolo[1,2-b]pyridazin-6-yl)-3-[(4-sulfamoylphenyl)carbamothioyl]urea |
|---|---|
| PubChem CID | 122179669 |
| Molecular Formula | C16H16N6O3S2 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-(5-methylpyrrolo[1,2-b]pyridazin-6-yl)-3-[(4-sulfamoylphenyl)carbamothioyl]urea |
| SMILES | Cc1c(NC(=O)NC(=S)Nc2ccc(S(N)(=O)=O)cc2)cn2ncccc12 |
| InChI | InChI=1S/C16H16N6O3S2/c1-10-13(9-22-14(10)3-2-8-18-22)20-15(23)21-16(26)19-11-4-6-12(7-5-11)27(17,24)25/h2-9H,1H3,(H2,17,24,25)(H3,19,20,21,23,26) |
| InChIKey | YSHXHWCKSMTDSO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 130.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|