C27H25FIN5O — CID 122180526
(1S)-1-[3-[2-(4-azido-3-(125I)iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile (PubChem CID 122180526) has the molecular formula C27H25FIN5O and a molecular weight of 579.43 g/mol. Its IUPAC name is (1S)-1-[3-[2-(4-azido-3-(125I)iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile.
| Compound Name | (1S)-1-[3-[2-(4-azido-3-(125I)iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 122180526 |
| Molecular Formula | C27H25FIN5O |
| Molecular Weight | 579.43 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | (1S)-1-[3-[2-(4-azido-3-(125I)iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| SMILES | CN(CCC[C@@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21)CCc1ccc(N=[N+]=[N-])c([125I])c1 |
| InChI | InChI=1S/C27H25FIN5O/c1-34(14-11-19-4-10-26(32-33-31)25(29)16-19)13-2-12-27(22-5-7-23(28)8-6-22)24-9-3-20(17-30)15-21(24)18-35-27/h3-10,15-16H,2,11-14,18H2,1H3/t27-/m0/s1/i29-2 |
| InChIKey | ARGHRTOHHSCKDO-FYPJILMUSA-N |
| XLogP | 6.97 |
| TPSA | 85.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.43 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|