C27H27FIN3O — CID 122232476
(1S)-1-[3-[2-(4-amino-3-iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile (PubChem CID 122232476) has the molecular formula C27H27FIN3O and a molecular weight of 555.44 g/mol. Its IUPAC name is (1S)-1-[3-[2-(4-amino-3-iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile.
| Compound Name | (1S)-1-[3-[2-(4-amino-3-iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
|---|---|
| PubChem CID | 122232476 |
| Molecular Formula | C27H27FIN3O |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | (1S)-1-[3-[2-(4-amino-3-iodophenyl)ethyl-methylamino]propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile |
| SMILES | CN(CCC[C@@]1(c2ccc(F)cc2)OCc2cc(C#N)ccc21)CCc1ccc(N)c(I)c1 |
| InChI | InChI=1S/C27H27FIN3O/c1-32(14-11-19-4-10-26(31)25(29)16-19)13-2-12-27(22-5-7-23(28)8-6-22)24-9-3-20(17-30)15-21(24)18-33-27/h3-10,15-16H,2,11-14,18,31H2,1H3/t27-/m0/s1 |
| InChIKey | FJEAMWVWKIUSQW-MHZLTWQESA-N |
| XLogP | 5.61 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|