C20H22N4O — CID 122180557
3-methyl-5-phenyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one (PubChem CID 122180557) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-methyl-5-phenyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one.
| Compound Name | 3-methyl-5-phenyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 122180557 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 3-methyl-5-phenyl-8-(piperidin-4-ylamino)-1H-1,7-naphthyridin-2-one |
| SMILES | Cc1cc2c(-c3ccccc3)cnc(NC3CCNCC3)c2[nH]c1=O |
| InChI | InChI=1S/C20H22N4O/c1-13-11-16-17(14-5-3-2-4-6-14)12-22-19(18(16)24-20(13)25)23-15-7-9-21-10-8-15/h2-6,11-12,15,21H,7-10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | YTGHVJNUPGANNO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |