C30H37F2N5O — CID 134817552
8-[[(1S,2R,3R,5R)-2-[2-(4,4-difluorocyclohexyl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-3-methyl-5-(5-methyl-3-pyridinyl)-1H-1,7-naphthyridin-2-one (PubChem CID 134817552) has the molecular formula C30H37F2N5O and a molecular weight of 521.66 g/mol. Its IUPAC name is 8-[[(1S,2R,3R,5R)-2-[2-(4,4-difluorocyclohexyl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-3-methyl-5-(5-methyl-3-pyridinyl)-1H-1,7-naphthyridin-2-one.
| Compound Name | 8-[[(1S,2R,3R,5R)-2-[2-(4,4-difluorocyclohexyl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-3-methyl-5-(5-methyl-3-pyridinyl)-1H-1,7-naphthyridin-2-one |
|---|---|
| PubChem CID | 134817552 |
| Molecular Formula | C30H37F2N5O |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 8-[[(1S,2R,3R,5R)-2-[2-(4,4-difluorocyclohexyl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-3-methyl-5-(5-methyl-3-pyridinyl)-1H-1,7-naphthyridin-2-one |
| SMILES | Cc1cncc(-c2cnc(N[C@@H]3C[C@H]4CC[C@H](N4)[C@H]3CCC3CCC(F)(F)CC3)c3[nH]c(=O)c(C)cc23)c1 |
| InChI | InChI=1S/C30H37F2N5O/c1-17-11-20(15-33-14-17)24-16-34-28(27-23(24)12-18(2)29(38)37-27)36-26-13-21-4-6-25(35-21)22(26)5-3-19-7-9-30(31,32)10-8-19/h11-12,14-16,19,21-22,25-26,35H,3-10,13H2,1-2H3,(H,34,36)(H,37,38)/t21-,22-,25+,26-/m1/s1 |
| InChIKey | XSDXNVMLXLEGSP-ULDOEVFSSA-N |
| XLogP | 6.13 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |