C14H18N4O2 — CID 122181372
4-[5-(4-methylphenyl)tetrazol-2-yl]butan-2-yl acetate (PubChem CID 122181372) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)tetrazol-2-yl]butan-2-yl acetate.
| Compound Name | 4-[5-(4-methylphenyl)tetrazol-2-yl]butan-2-yl acetate |
|---|---|
| PubChem CID | 122181372 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[5-(4-methylphenyl)tetrazol-2-yl]butan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCn1nnc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C14H18N4O2/c1-10-4-6-13(7-5-10)14-15-17-18(16-14)9-8-11(2)20-12(3)19/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | BJHHVYYBSSGRQH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |