C19H19NO5 — CID 122182221
(2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-4-yl)methanone (PubChem CID 122182221) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-4-yl)methanone.
| Compound Name | (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-4-yl)methanone |
|---|---|
| PubChem CID | 122182221 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-4-yl)methanone |
| SMILES | COc1cc(C(=O)c2cccc3c2ccn3C)c(O)c(OC)c1OC |
| InChI | InChI=1S/C19H19NO5/c1-20-9-8-11-12(6-5-7-14(11)20)16(21)13-10-15(23-2)18(24-3)19(25-4)17(13)22/h5-10,22H,1-4H3 |
| InChIKey | RQJPASTYYAJBDJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |