C24H22O5 — CID 122183423
3-hexyl-11-hydroxy-5-methylnaphtho[2,3-h]chromene-2,7,12-trione (PubChem CID 122183423) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-hexyl-11-hydroxy-5-methylnaphtho[2,3-h]chromene-2,7,12-trione.
| Compound Name | 3-hexyl-11-hydroxy-5-methylnaphtho[2,3-h]chromene-2,7,12-trione |
|---|---|
| PubChem CID | 122183423 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-hexyl-11-hydroxy-5-methylnaphtho[2,3-h]chromene-2,7,12-trione |
| SMILES | CCCCCCc1cc2c(C)cc3c(c2oc1=O)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C24H22O5/c1-3-4-5-6-8-14-12-16-13(2)11-17-20(23(16)29-24(14)28)22(27)19-15(21(17)26)9-7-10-18(19)25/h7,9-12,25H,3-6,8H2,1-2H3 |
| InChIKey | ZZZIZYDLRROFQT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|