C21H30Cl2N6O2 — CID 122186863
3,5-diamino-6-chloro-N-[(1S,3S)-1-[3-(4-methoxyphenyl)propyl]-1-methylpiperidin-1-ium-3-yl]pyrazine-2-carboxamide chloride (PubChem CID 122186863) has the molecular formula C21H30Cl2N6O2 and a molecular weight of 469.42 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[(1S,3S)-1-[3-(4-methoxyphenyl)propyl]-1-methylpiperidin-1-ium-3-yl]pyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-6-chloro-N-[(1S,3S)-1-[3-(4-methoxyphenyl)propyl]-1-methylpiperidin-1-ium-3-yl]pyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 122186863 |
| Molecular Formula | C21H30Cl2N6O2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[(1S,3S)-1-[3-(4-methoxyphenyl)propyl]-1-methylpiperidin-1-ium-3-yl]pyrazine-2-carboxamide chloride |
| SMILES | COc1ccc(CCC[N@@+]2(C)CCC[C@H](NC(=O)c3nc(Cl)c(N)nc3N)C2)cc1.[Cl-] |
| InChI | InChI=1S/C21H29ClN6O2.ClH/c1-28(11-3-5-14-7-9-16(30-2)10-8-14)12-4-6-15(13-28)25-21(29)17-19(23)27-20(24)18(22)26-17;/h7-10,15H,3-6,11-13H2,1-2H3,(H4-,23,24,25,27,29);1H/t15-,28-;/m0./s1 |
| InChIKey | ZSLPIEXMHYWZBC-BTHZRPCFSA-N |
| XLogP | -0.72 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|