C28H37BrClN7O3 — CID 57402003
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butyl]azanium bromide (PubChem CID 57402003) has the molecular formula C28H37BrClN7O3 and a molecular weight of 635.01 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butyl]azanium bromide.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butyl]azanium bromide |
|---|---|
| PubChem CID | 57402003 |
| Molecular Formula | C28H37BrClN7O3 |
| Molecular Weight | 635.01 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butyl]azanium bromide |
| SMILES | C[N+](C)(CCCCNC(=O)Cc1ccc(OCc2ccccc2)cc1)CCNC(=O)c1nc(Cl)c(N)nc1N.[Br-] |
| InChI | InChI=1S/C28H36ClN7O3.BrH/c1-36(2,17-15-33-28(38)24-26(30)35-27(31)25(29)34-24)16-7-6-14-32-23(37)18-20-10-12-22(13-11-20)39-19-21-8-4-3-5-9-21;/h3-5,8-13H,6-7,14-19H2,1-2H3,(H5-,30,31,32,33,35,37,38);1H |
| InChIKey | KFEPDUMPYCQNSE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.01 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|