C38H54Cl2N8O7 — CID 122186867
3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride (PubChem CID 122186867) has the molecular formula C38H54Cl2N8O7 and a molecular weight of 805.80 g/mol. Its IUPAC name is 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride.
| Compound Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride |
|---|---|
| PubChem CID | 122186867 |
| Molecular Formula | C38H54Cl2N8O7 |
| Molecular Weight | 805.80 g/mol |
| Exact Mass | 804.35 |
| IUPAC Name | 3,5-diamino-N-[(3S)-1,1-bis[3-[4-[2-(3-hydroxypropylamino)-2-oxoethoxy]phenyl]propyl]piperidin-1-ium-3-yl]-6-chloropyrazine-2-carboxamide chloride |
| SMILES | Nc1nc(N)c(C(=O)N[C@H]2CCC[N+](CCCc3ccc(OCC(=O)NCCCO)cc3)(CCCc3ccc(OCC(=O)NCCCO)cc3)C2)nc1Cl.[Cl-] |
| InChI | InChI=1S/C38H53ClN8O7.ClH/c39-35-37(41)46-36(40)34(45-35)38(52)44-29-8-3-21-47(24-29,19-1-6-27-9-13-30(14-10-27)53-25-32(50)42-17-4-22-48)20-2-7-28-11-15-31(16-12-28)54-26-33(51)43-18-5-23-49;/h9-16,29,48-49H,1-8,17-26H2,(H6-,40,41,42,43,44,46,50,51,52);1H/t29-;/m0./s1 |
| InChIKey | DDNJBCVKJFTXST-JMAPEOGHSA-N |
| XLogP | -0.97 |
| TPSA | 224.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.80 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|