C37H48BrClN6O4 — CID 57402027
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-tris[3-(4-methoxyphenyl)propyl]azanium bromide (PubChem CID 57402027) has the molecular formula C37H48BrClN6O4 and a molecular weight of 756.19 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-tris[3-(4-methoxyphenyl)propyl]azanium bromide.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-tris[3-(4-methoxyphenyl)propyl]azanium bromide |
|---|---|
| PubChem CID | 57402027 |
| Molecular Formula | C37H48BrClN6O4 |
| Molecular Weight | 756.19 g/mol |
| Exact Mass | 754.26 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-tris[3-(4-methoxyphenyl)propyl]azanium bromide |
| SMILES | COc1ccc(CCC[N+](CCCc2ccc(OC)cc2)(CCCc2ccc(OC)cc2)CCNC(=O)c2nc(Cl)c(N)nc2N)cc1.[Br-] |
| InChI | InChI=1S/C37H47ClN6O4.BrH/c1-46-30-16-10-27(11-17-30)7-4-23-44(24-5-8-28-12-18-31(47-2)19-13-28,25-6-9-29-14-20-32(48-3)21-15-29)26-22-41-37(45)33-35(39)43-36(40)34(38)42-33;/h10-21H,4-9,22-26H2,1-3H3,(H4-,39,40,41,43,45);1H |
| InChIKey | PJLXWOQYNZGITN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|