C29H39BrClN7O3 — CID 57393283
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-phenylmethoxyphenyl)propanoylamino]butyl]azanium bromide (PubChem CID 57393283) has the molecular formula C29H39BrClN7O3 and a molecular weight of 649.03 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-phenylmethoxyphenyl)propanoylamino]butyl]azanium bromide.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-phenylmethoxyphenyl)propanoylamino]butyl]azanium bromide |
|---|---|
| PubChem CID | 57393283 |
| Molecular Formula | C29H39BrClN7O3 |
| Molecular Weight | 649.03 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-dimethyl-[4-[3-(4-phenylmethoxyphenyl)propanoylamino]butyl]azanium bromide |
| SMILES | C[N+](C)(CCCCNC(=O)CCc1ccc(OCc2ccccc2)cc1)CCNC(=O)c1nc(Cl)c(N)nc1N.[Br-] |
| InChI | InChI=1S/C29H38ClN7O3.BrH/c1-37(2,19-17-34-29(39)25-27(31)36-28(32)26(30)35-25)18-7-6-16-33-24(38)15-12-21-10-13-23(14-11-21)40-20-22-8-4-3-5-9-22;/h3-5,8-11,13-14H,6-7,12,15-20H2,1-2H3,(H5-,31,32,33,34,36,38,39);1H |
| InChIKey | BMUMSNJJOWRABY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.03 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|