C28H38BrClN6O3 — CID 57398587
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-bis[3-(4-methoxyphenyl)propyl]-methylazanium bromide (PubChem CID 57398587) has the molecular formula C28H38BrClN6O3 and a molecular weight of 622.01 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-bis[3-(4-methoxyphenyl)propyl]-methylazanium bromide.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-bis[3-(4-methoxyphenyl)propyl]-methylazanium bromide |
|---|---|
| PubChem CID | 57398587 |
| Molecular Formula | C28H38BrClN6O3 |
| Molecular Weight | 622.01 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-bis[3-(4-methoxyphenyl)propyl]-methylazanium bromide |
| SMILES | COc1ccc(CCC[N+](C)(CCCc2ccc(OC)cc2)CCNC(=O)c2nc(Cl)c(N)nc2N)cc1.[Br-] |
| InChI | InChI=1S/C28H37ClN6O3.BrH/c1-35(17-4-6-20-8-12-22(37-2)13-9-20,18-5-7-21-10-14-23(38-3)15-11-21)19-16-32-28(36)24-26(30)34-27(31)25(29)33-24;/h8-15H,4-7,16-19H2,1-3H3,(H4-,30,31,32,34,36);1H |
| InChIKey | WJAQDFBBJFNPLQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.01 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|