C17H17FN6OS — CID 122187069
[8,8-dimethyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 122187069) has the molecular formula C17H17FN6OS and a molecular weight of 372.43 g/mol. Its IUPAC name is [8,8-dimethyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [8,8-dimethyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 122187069 |
| Molecular Formula | C17H17FN6OS |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [8,8-dimethyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | Cc1nsc(-c2nnc3n2CCN(C(=O)c2ccc(F)cc2)C3(C)C)n1 |
| InChI | InChI=1S/C17H17FN6OS/c1-10-19-14(26-22-10)13-20-21-16-17(2,3)24(9-8-23(13)16)15(25)11-4-6-12(18)7-5-11/h4-7H,8-9H2,1-3H3 |
| InChIKey | CGCSZFVIPKLGCF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |