C18H18FN7OS — CID 170190975
[(8R)-3-[3-(azetidin-1-yl)-1,2,4-thiadiazol-5-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 170190975) has the molecular formula C18H18FN7OS and a molecular weight of 399.46 g/mol. Its IUPAC name is [(8R)-3-[3-(azetidin-1-yl)-1,2,4-thiadiazol-5-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(8R)-3-[3-(azetidin-1-yl)-1,2,4-thiadiazol-5-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 170190975 |
| Molecular Formula | C18H18FN7OS |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [(8R)-3-[3-(azetidin-1-yl)-1,2,4-thiadiazol-5-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | C[C@@H]1c2nnc(-c3nc(N4CCC4)ns3)n2CCN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN7OS/c1-11-14-21-22-15(16-20-18(23-28-16)24-7-2-8-24)26(14)10-9-25(11)17(27)12-3-5-13(19)6-4-12/h3-6,11H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | IBNAIOUYUSGPQH-LLVKDONJSA-N |
| XLogP | 2.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |