C22H16Cl2FN5OS — CID 67451720
[3-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 67451720) has the molecular formula C22H16Cl2FN5OS and a molecular weight of 488.38 g/mol. Its IUPAC name is [3-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [3-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67451720 |
| Molecular Formula | C22H16Cl2FN5OS |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [3-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | CC1c2nnc(-c3csc(-c4ccc(Cl)cc4Cl)n3)n2CCN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16Cl2FN5OS/c1-12-19-27-28-20(18-11-32-21(26-18)16-7-4-14(23)10-17(16)24)30(19)9-8-29(12)22(31)13-2-5-15(25)6-3-13/h2-7,10-12H,8-9H2,1H3 |
| InChIKey | IWLGETFMGNLGMQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |