C17H12F5N5OS — CID 86274838
(3,4-difluorophenyl)-[(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 86274838) has the molecular formula C17H12F5N5OS and a molecular weight of 429.37 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 86274838 |
| Molecular Formula | C17H12F5N5OS |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | (3,4-difluorophenyl)-[(8R)-8-methyl-3-[2-(trifluoromethyl)-1,3-thiazol-4-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1c2nnc(-c3csc(C(F)(F)F)n3)n2CCN1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12F5N5OS/c1-8-13-24-25-14(12-7-29-16(23-12)17(20,21)22)27(13)5-4-26(8)15(28)9-2-3-10(18)11(19)6-9/h2-3,6-8H,4-5H2,1H3/t8-/m1/s1 |
| InChIKey | KTZUFWFRVQNNLJ-MRVPVSSYSA-N |
| XLogP | 3.92 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |