C19H17F2N5OS — CID 155711731
[(8R)-3-(2-cyclopropyl-1,3-thiazol-4-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(3,4-difluorophenyl)methanone (PubChem CID 155711731) has the molecular formula C19H17F2N5OS and a molecular weight of 401.44 g/mol. Its IUPAC name is [(8R)-3-(2-cyclopropyl-1,3-thiazol-4-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(8R)-3-(2-cyclopropyl-1,3-thiazol-4-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 155711731 |
| Molecular Formula | C19H17F2N5OS |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [(8R)-3-(2-cyclopropyl-1,3-thiazol-4-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(3,4-difluorophenyl)methanone |
| SMILES | C[C@@H]1c2nnc(-c3csc(C4CC4)n3)n2CCN1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2N5OS/c1-10-16-23-24-17(15-9-28-18(22-15)11-2-3-11)26(16)7-6-25(10)19(27)12-4-5-13(20)14(21)8-12/h4-5,8-11H,2-3,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | SXORZSOLSGOBBU-SNVBAGLBSA-N |
| XLogP | 3.77 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |