C15H14FN7OS — CID 162686540
[(8R)-3-(3-amino-1,2,4-thiadiazol-5-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone (PubChem CID 162686540) has the molecular formula C15H14FN7OS and a molecular weight of 359.39 g/mol. Its IUPAC name is [(8R)-3-(3-amino-1,2,4-thiadiazol-5-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(8R)-3-(3-amino-1,2,4-thiadiazol-5-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 162686540 |
| Molecular Formula | C15H14FN7OS |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [(8R)-3-(3-amino-1,2,4-thiadiazol-5-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-fluorophenyl)methanone |
| SMILES | C[C@@H]1c2nnc(-c3nc(N)ns3)n2CCN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN7OS/c1-8-11-19-20-12(13-18-15(17)21-25-13)23(11)7-6-22(8)14(24)9-2-4-10(16)5-3-9/h2-5,8H,6-7H2,1H3,(H2,17,21)/t8-/m1/s1 |
| InChIKey | PULWDEADVROYOY-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |