C18H16N6OS2 — CID 177370981
1-benzothiophen-6-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 177370981) has the molecular formula C18H16N6OS2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-benzothiophen-6-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | 1-benzothiophen-6-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 177370981 |
| Molecular Formula | C18H16N6OS2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-benzothiophen-6-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | Cc1nsc(-c2nnc3n2CCN(C(=O)c2ccc4ccsc4c2)[C@@H]3C)n1 |
| InChI | InChI=1S/C18H16N6OS2/c1-10-15-20-21-16(17-19-11(2)22-27-17)24(15)7-6-23(10)18(25)13-4-3-12-5-8-26-14(12)9-13/h3-5,8-10H,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | XWHFGBWCVDIRBW-SNVBAGLBSA-N |
| XLogP | 3.54 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |