C18H17N7OS — CID 166067706
1H-indol-5-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 166067706) has the molecular formula C18H17N7OS and a molecular weight of 379.45 g/mol. Its IUPAC name is 1H-indol-5-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | 1H-indol-5-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 166067706 |
| Molecular Formula | C18H17N7OS |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1H-indol-5-yl-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | Cc1nsc(-c2nnc3n2CCN(C(=O)c2ccc4[nH]ccc4c2)[C@@H]3C)n1 |
| InChI | InChI=1S/C18H17N7OS/c1-10-15-21-22-16(17-20-11(2)23-27-17)25(15)8-7-24(10)18(26)13-3-4-14-12(9-13)5-6-19-14/h3-6,9-10,19H,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | RQYCECNZCMDFTK-SNVBAGLBSA-N |
| XLogP | 2.80 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |