C19H20N4O3 — CID 122187749
1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea (PubChem CID 122187749) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea.
| Compound Name | 1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 122187749 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(2R,10bS)-2-hydroxy-6-oxo-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-10-yl]-3-(3-methyl-2-pyridinyl)urea |
| SMILES | Cc1cccnc1NC(=O)Nc1cccc2c1[C@@H]1C[C@H](O)CCN1C2=O |
| InChI | InChI=1S/C19H20N4O3/c1-11-4-3-8-20-17(11)22-19(26)21-14-6-2-5-13-16(14)15-10-12(24)7-9-23(15)18(13)25/h2-6,8,12,15,24H,7,9-10H2,1H3,(H2,20,21,22,26)/t12-,15+/m1/s1 |
| InChIKey | HGUSGBLHYRXWQF-DOMZBBRYSA-N |
| XLogP | 2.69 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |