C21H21N5O6S — CID 122188324
ethyl 4-[2-oxo-8-(4-sulfamoylanilino)-[1,3]oxazolo[4,5-g]quinazolin-1-yl]butanoate (PubChem CID 122188324) has the molecular formula C21H21N5O6S and a molecular weight of 471.50 g/mol. Its IUPAC name is ethyl 4-[2-oxo-8-(4-sulfamoylanilino)-[1,3]oxazolo[4,5-g]quinazolin-1-yl]butanoate.
| Compound Name | ethyl 4-[2-oxo-8-(4-sulfamoylanilino)-[1,3]oxazolo[4,5-g]quinazolin-1-yl]butanoate |
|---|---|
| PubChem CID | 122188324 |
| Molecular Formula | C21H21N5O6S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | ethyl 4-[2-oxo-8-(4-sulfamoylanilino)-[1,3]oxazolo[4,5-g]quinazolin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1c(=O)oc2cc3ncnc(Nc4ccc(S(N)(=O)=O)cc4)c3cc21 |
| InChI | InChI=1S/C21H21N5O6S/c1-2-31-19(27)4-3-9-26-17-10-15-16(11-18(17)32-21(26)28)23-12-24-20(15)25-13-5-7-14(8-6-13)33(22,29)30/h5-8,10-12H,2-4,9H2,1H3,(H2,22,29,30)(H,23,24,25) |
| InChIKey | LUWMLLVIYPQKMX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |