C22H23N5O4 — CID 70682361
8-(2-hydroxyanilino)-1-(3-morpholin-4-ylpropyl)-[1,3]oxazolo[4,5-g]quinazolin-2-one (PubChem CID 70682361) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 8-(2-hydroxyanilino)-1-(3-morpholin-4-ylpropyl)-[1,3]oxazolo[4,5-g]quinazolin-2-one.
| Compound Name | 8-(2-hydroxyanilino)-1-(3-morpholin-4-ylpropyl)-[1,3]oxazolo[4,5-g]quinazolin-2-one |
|---|---|
| PubChem CID | 70682361 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 8-(2-hydroxyanilino)-1-(3-morpholin-4-ylpropyl)-[1,3]oxazolo[4,5-g]quinazolin-2-one |
| SMILES | O=c1oc2cc3ncnc(Nc4ccccc4O)c3cc2n1CCCN1CCOCC1 |
| InChI | InChI=1S/C22H23N5O4/c28-19-5-2-1-4-16(19)25-21-15-12-18-20(13-17(15)23-14-24-21)31-22(29)27(18)7-3-6-26-8-10-30-11-9-26/h1-2,4-5,12-14,28H,3,6-11H2,(H,23,24,25) |
| InChIKey | VMIQKNBDZRNRNG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|