C18H9Cl4NO — CID 122188343
(E)-3-(2-chloroquinolin-3-yl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one (PubChem CID 122188343) has the molecular formula C18H9Cl4NO and a molecular weight of 397.09 g/mol. Its IUPAC name is (E)-3-(2-chloroquinolin-3-yl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloroquinolin-3-yl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122188343 |
| Molecular Formula | C18H9Cl4NO |
| Molecular Weight | 397.09 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | (E)-3-(2-chloroquinolin-3-yl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc2ccccc2nc1Cl)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H9Cl4NO/c19-13-7-6-12(16(20)17(13)21)15(24)8-5-11-9-10-3-1-2-4-14(10)23-18(11)22/h1-9H/b8-5+ |
| InChIKey | BHTWKFGWNJYXRJ-VMPITWQZSA-N |
| XLogP | 6.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.09 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|