C19H16ClNOS — CID 57396404
(E)-3-(2-chloro-7-methylquinolin-3-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 57396404) has the molecular formula C19H16ClNOS and a molecular weight of 341.86 g/mol. Its IUPAC name is (E)-3-(2-chloro-7-methylquinolin-3-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chloro-7-methylquinolin-3-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57396404 |
| Molecular Formula | C19H16ClNOS |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (E)-3-(2-chloro-7-methylquinolin-3-yl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | Cc1ccc2cc(/C=C/C(=O)c3cc(C)sc3C)c(Cl)nc2c1 |
| InChI | InChI=1S/C19H16ClNOS/c1-11-4-5-14-10-15(19(20)21-17(14)8-11)6-7-18(22)16-9-12(2)23-13(16)3/h4-10H,1-3H3/b7-6+ |
| InChIKey | XPBWZLKWQPPSGC-VOTSOKGWSA-N |
| XLogP | 5.77 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|