C33H34N2O5 — CID 122188924
4-[4-[2-[(4-phenylbenzoyl)amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid (PubChem CID 122188924) has the molecular formula C33H34N2O5 and a molecular weight of 538.64 g/mol. Its IUPAC name is 4-[4-[2-[(4-phenylbenzoyl)amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[(4-phenylbenzoyl)amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 122188924 |
| Molecular Formula | C33H34N2O5 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 4-[4-[2-[(4-phenylbenzoyl)amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
| SMILES | O=C(NCCNC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(OC2C3CC4CC2CC(C(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C33H34N2O5/c36-30(24-8-6-23(7-9-24)22-4-2-1-3-5-22)34-14-15-35-31(37)25-10-12-28(13-11-25)40-29-26-16-21-17-27(29)20-33(18-21,19-26)32(38)39/h1-13,21,26-27,29H,14-20H2,(H,34,36)(H,35,37)(H,38,39) |
| InChIKey | WLGUPSVJWVWDIP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|