C33H32Cl2N2O5 — CID 122188936
4-[4-[2-[[4-(2,6-dichlorophenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid (PubChem CID 122188936) has the molecular formula C33H32Cl2N2O5 and a molecular weight of 607.53 g/mol. Its IUPAC name is 4-[4-[2-[[4-(2,6-dichlorophenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[[4-(2,6-dichlorophenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 122188936 |
| Molecular Formula | C33H32Cl2N2O5 |
| Molecular Weight | 607.53 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | 4-[4-[2-[[4-(2,6-dichlorophenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
| SMILES | O=C(NCCNC(=O)c1ccc(-c2c(Cl)cccc2Cl)cc1)c1ccc(OC2C3CC4CC2CC(C(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C33H32Cl2N2O5/c34-26-2-1-3-27(35)28(26)20-4-6-21(7-5-20)30(38)36-12-13-37-31(39)22-8-10-25(11-9-22)42-29-23-14-19-15-24(29)18-33(16-19,17-23)32(40)41/h1-11,19,23-24,29H,12-18H2,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | MCWSZBQKJPIVDK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|