C29H30N6O3 — CID 122190824
3-(dimethylamino)-N-[2-[[4-[6-(4-methoxyanilino)pyrimidin-4-yl]benzoyl]amino]ethyl]benzamide (PubChem CID 122190824) has the molecular formula C29H30N6O3 and a molecular weight of 510.60 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[2-[[4-[6-(4-methoxyanilino)pyrimidin-4-yl]benzoyl]amino]ethyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[2-[[4-[6-(4-methoxyanilino)pyrimidin-4-yl]benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122190824 |
| Molecular Formula | C29H30N6O3 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 3-(dimethylamino)-N-[2-[[4-[6-(4-methoxyanilino)pyrimidin-4-yl]benzoyl]amino]ethyl]benzamide |
| SMILES | COc1ccc(Nc2cc(-c3ccc(C(=O)NCCNC(=O)c4cccc(N(C)C)c4)cc3)ncn2)cc1 |
| InChI | InChI=1S/C29H30N6O3/c1-35(2)24-6-4-5-22(17-24)29(37)31-16-15-30-28(36)21-9-7-20(8-10-21)26-18-27(33-19-32-26)34-23-11-13-25(38-3)14-12-23/h4-14,17-19H,15-16H2,1-3H3,(H,30,36)(H,31,37)(H,32,33,34) |
| InChIKey | KXAYALPFYVNKDH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|