C23H22N4O3 — CID 122191415
N-[(E)-[4-[2-[(4-methylphenyl)methylamino]-2-oxoethoxy]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 122191415) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[(E)-[4-[2-[(4-methylphenyl)methylamino]-2-oxoethoxy]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[4-[2-[(4-methylphenyl)methylamino]-2-oxoethoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 122191415 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[(E)-[4-[2-[(4-methylphenyl)methylamino]-2-oxoethoxy]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)COc2ccc(/C=N/NC(=O)c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-17-2-4-18(5-3-17)14-25-22(28)16-30-21-8-6-19(7-9-21)15-26-27-23(29)20-10-12-24-13-11-20/h2-13,15H,14,16H2,1H3,(H,25,28)(H,27,29)/b26-15+ |
| InChIKey | YNNGYBQSCLNOAU-CVKSISIWSA-N |
| XLogP | 2.85 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|