C30H46N4O4S — CID 122193070
N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxo-3-thiophen-3-ylpropan-2-yl]decanamide (PubChem CID 122193070) has the molecular formula C30H46N4O4S and a molecular weight of 558.79 g/mol. Its IUPAC name is N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxo-3-thiophen-3-ylpropan-2-yl]decanamide.
| Compound Name | N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxo-3-thiophen-3-ylpropan-2-yl]decanamide |
|---|---|
| PubChem CID | 122193070 |
| Molecular Formula | C30H46N4O4S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | N-[(2S)-1-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-1-oxo-3-thiophen-3-ylpropan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cc1ccsc1)C(=O)N[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C30H46N4O4S/c1-4-5-6-7-8-9-10-14-28(36)32-26(20-23-17-19-39-21-23)30(38)34-25-13-11-12-18-31-27(35)16-15-24(22(2)3)33-29(25)37/h11,13,15-17,19,21-22,24-26H,4-10,12,14,18,20H2,1-3H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38)/b13-11+,16-15+/t24-,25+,26+/m1/s1 |
| InChIKey | WCPBTUQSIHQPQG-QBXQOWHBSA-N |
| XLogP | 4.17 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|