C33H50N4O4 — CID 122193074
N-[(2S)-4-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-4-oxo-1-phenylbutan-2-yl]decanamide (PubChem CID 122193074) has the molecular formula C33H50N4O4 and a molecular weight of 566.79 g/mol. Its IUPAC name is N-[(2S)-4-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-4-oxo-1-phenylbutan-2-yl]decanamide.
| Compound Name | N-[(2S)-4-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-4-oxo-1-phenylbutan-2-yl]decanamide |
|---|---|
| PubChem CID | 122193074 |
| Molecular Formula | C33H50N4O4 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | N-[(2S)-4-[[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-4-oxo-1-phenylbutan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@H](CC(=O)N[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O)Cc1ccccc1 |
| InChI | InChI=1S/C33H50N4O4/c1-4-5-6-7-8-9-13-19-31(39)35-27(23-26-16-11-10-12-17-26)24-32(40)36-29-18-14-15-22-34-30(38)21-20-28(25(2)3)37-33(29)41/h10-12,14,16-18,20-21,25,27-29H,4-9,13,15,19,22-24H2,1-3H3,(H,34,38)(H,35,39)(H,36,40)(H,37,41)/b18-14+,21-20+/t27-,28+,29-/m0/s1 |
| InChIKey | PLJQNBXOIWNPDA-OUKZHJAKSA-N |
| XLogP | 4.50 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|