C35H52N4O4 — CID 122193073
(2S)-2-benzyl-1-decanoyl-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]pyrrolidine-2-carboxamide (PubChem CID 122193073) has the molecular formula C35H52N4O4 and a molecular weight of 592.83 g/mol. Its IUPAC name is (2S)-2-benzyl-1-decanoyl-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-2-benzyl-1-decanoyl-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122193073 |
| Molecular Formula | C35H52N4O4 |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.40 |
| IUPAC Name | (2S)-2-benzyl-1-decanoyl-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCCCCCCCC(=O)N1CCC[C@]1(Cc1ccccc1)C(=O)N[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C35H52N4O4/c1-4-5-6-7-8-9-13-20-32(41)39-25-16-23-35(39,26-28-17-11-10-12-18-28)34(43)38-30-19-14-15-24-36-31(40)22-21-29(27(2)3)37-33(30)42/h10-12,14,17-19,21-22,27,29-30H,4-9,13,15-16,20,23-26H2,1-3H3,(H,36,40)(H,37,42)(H,38,43)/b19-14+,22-21+/t29-,30+,35+/m1/s1 |
| InChIKey | CFZJYOUKLAJCMM-POWDOBCOSA-N |
| XLogP | 4.99 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|