C13H23N3O3 — CID 170368786
(3E,5S,8S,10S)-8-amino-10-hydroxy-5-propan-2-yl-1,6-diazacyclododec-3-ene-2,7-dione (PubChem CID 170368786) has the molecular formula C13H23N3O3 and a molecular weight of 269.35 g/mol. Its IUPAC name is (3E,5S,8S,10S)-8-amino-10-hydroxy-5-propan-2-yl-1,6-diazacyclododec-3-ene-2,7-dione.
| Compound Name | (3E,5S,8S,10S)-8-amino-10-hydroxy-5-propan-2-yl-1,6-diazacyclododec-3-ene-2,7-dione |
|---|---|
| PubChem CID | 170368786 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | (3E,5S,8S,10S)-8-amino-10-hydroxy-5-propan-2-yl-1,6-diazacyclododec-3-ene-2,7-dione |
| SMILES | CC(C)[C@H]1/C=C/C(=O)NCC[C@H](O)C[C@H](N)C(=O)N1 |
| InChI | InChI=1S/C13H23N3O3/c1-8(2)11-3-4-12(18)15-6-5-9(17)7-10(14)13(19)16-11/h3-4,8-11,17H,5-7,14H2,1-2H3,(H,15,18)(H,16,19)/b4-3+/t9-,10-,11+/m0/s1 |
| InChIKey | NATBZXFEHNTRQU-MPZJWQKYSA-N |
| XLogP | -0.72 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |