C17H28N4O4 — CID 70876952
(2S,3R)-2-amino-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-hydroxybutanamide (PubChem CID 70876952) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S,3R)-2-amino-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-hydroxybutanamide.
| Compound Name | (2S,3R)-2-amino-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 70876952 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S,3R)-2-amino-N-[(3E,5S,8S,9E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]-3-hydroxybutanamide |
| SMILES | CC(C)[C@H]1/C=C/C(=O)NCC/C=C/[C@H](NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N1 |
| InChI | InChI=1S/C17H28N4O4/c1-10(2)12-7-8-14(23)19-9-5-4-6-13(16(24)20-12)21-17(25)15(18)11(3)22/h4,6-8,10-13,15,22H,5,9,18H2,1-3H3,(H,19,23)(H,20,24)(H,21,25)/b6-4+,8-7+/t11-,12-,13+,15+/m1/s1 |
| InChIKey | XHRBSAQUNCQPSD-TYUXJFNQSA-N |
| XLogP | -1.05 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|