C17H26N6O5 — CID 123979506
2-(methylcarbamoylamino)-N-(5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl)butanediamide (PubChem CID 123979506) has the molecular formula C17H26N6O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-(methylcarbamoylamino)-N-(5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl)butanediamide.
| Compound Name | 2-(methylcarbamoylamino)-N-(5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl)butanediamide |
|---|---|
| PubChem CID | 123979506 |
| Molecular Formula | C17H26N6O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-(methylcarbamoylamino)-N-(5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl)butanediamide |
| SMILES | CNC(=O)NC(CC(N)=O)C(=O)NC1C=CCCNC(=O)C=CC(C)NC1=O |
| InChI | InChI=1S/C17H26N6O5/c1-10-6-7-14(25)20-8-4-3-5-11(15(26)21-10)22-16(27)12(9-13(18)24)23-17(28)19-2/h3,5-7,10-12H,4,8-9H2,1-2H3,(H2,18,24)(H,20,25)(H,21,26)(H,22,27)(H2,19,23,28) |
| InChIKey | DLQWJXSNJNTAJL-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|