C19H28N4O6 — CID 157319882
4-(methylcarbamoylamino)-6-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-5-oxohexanoic acid (PubChem CID 157319882) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-(methylcarbamoylamino)-6-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-5-oxohexanoic acid.
| Compound Name | 4-(methylcarbamoylamino)-6-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 157319882 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-(methylcarbamoylamino)-6-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-5-oxohexanoic acid |
| SMILES | CNC(=O)NC(CCC(=O)O)C(=O)C[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C)NC1=O |
| InChI | InChI=1S/C19H28N4O6/c1-12-6-8-16(25)21-10-4-3-5-13(18(28)22-12)11-15(24)14(7-9-17(26)27)23-19(29)20-2/h3,5-6,8,12-14H,4,7,9-11H2,1-2H3,(H,21,25)(H,22,28)(H,26,27)(H2,20,23,29)/b5-3+,8-6+/t12-,13+,14?/m0/s1 |
| InChIKey | ACSBFNIFJXXXTI-CEHQDCMSSA-N |
| XLogP | -0.14 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|