C24H38N4O5 — CID 177261528
(2E,4E)-N-[(2S)-1-[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]-7-methylocta-2,4-dienamide (PubChem CID 177261528) has the molecular formula C24H38N4O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is (2E,4E)-N-[(2S)-1-[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]-7-methylocta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(2S)-1-[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]-7-methylocta-2,4-dienamide |
|---|---|
| PubChem CID | 177261528 |
| Molecular Formula | C24H38N4O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (2E,4E)-N-[(2S)-1-[[(3E,5S,8S,10S)-10-hydroxy-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]-7-methylocta-2,4-dienamide |
| SMILES | CC[C@H](NC(=O)/C=C/C=C/CC(C)C)C(=O)N[C@H]1C[C@@H](O)CCNC(=O)/C=C/[C@H](C)NC1=O |
| InChI | InChI=1S/C24H38N4O5/c1-5-19(27-22(31)10-8-6-7-9-16(2)3)23(32)28-20-15-18(29)13-14-25-21(30)12-11-17(4)26-24(20)33/h6-8,10-12,16-20,29H,5,9,13-15H2,1-4H3,(H,25,30)(H,26,33)(H,27,31)(H,28,32)/b7-6+,10-8+,12-11+/t17-,18-,19-,20-/m0/s1 |
| InChIKey | PDSGBJDZVFBOMS-MNLZARMCSA-N |
| XLogP | 0.86 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|